C21H25N3O2S — CID 45256788
2-[2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,6,6-tetradeuteriopiperazin-1-yl)-1,1,2,2-tetradeuterioethoxy]ethanol (PubChem CID 45256788) has the molecular formula C21H25N3O2S and a molecular weight of 391.57 g/mol. Its IUPAC name is 2-[2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,6,6-tetradeuteriopiperazin-1-yl)-1,1,2,2-tetradeuterioethoxy]ethanol.
| Compound Name | 2-[2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,6,6-tetradeuteriopiperazin-1-yl)-1,1,2,2-tetradeuterioethoxy]ethanol |
|---|---|
| PubChem CID | 45256788 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 391.57 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 2-[2-(4-benzo[b][1,4]benzothiazepin-6-yl-2,2,6,6-tetradeuteriopiperazin-1-yl)-1,1,2,2-tetradeuterioethoxy]ethanol |
| SMILES | [2H]C1([2H])CN(C2=Nc3ccccc3Sc3ccccc32)CC([2H])([2H])N1C([2H])([2H])C([2H])([2H])OCCO |
| InChI | InChI=1S/C21H25N3O2S/c25-14-16-26-15-13-23-9-11-24(12-10-23)21-17-5-1-3-7-19(17)27-20-8-4-2-6-18(20)22-21/h1-8,25H,9-16H2/i9D2,10D2,13D2,15D2 |
| InChIKey | URKOMYMAXPYINW-KFBJCPFESA-N |
| XLogP | 2.86 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |