About 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid
5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (PubChem CID 45256863) has the molecular formula C24H17F2N3O3
and a molecular weight of 433.41 g/mol. Its IUPAC name is 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| PubChem CID | 45256863 |
| Molecular Formula | C24H17F2N3O3 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| SMILES | Cc1ccc(Oc2nc3c(F)c(-c4ccc5c(ccn5C)c4)c(F)cc3[nH]2)cc1C(=O)O |
| InChI | InChI=1S/C24H17F2N3O3/c1-12-3-5-15(10-16(12)23(30)31)32-24-27-18-11-17(25)20(21(26)22(18)28-24)14-4-6-19-13(9-14)7-8-29(19)2/h3-11H,1-2H3,(H,27,28)(H,30,31) |
| InChIKey | JMUKPJFSDCHARV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
The IUPAC name of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (CID 45256863) is 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid.
What is the SMILES notation for 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
The canonical SMILES for 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid is Cc1ccc(Oc2nc3c(F)c(-c4ccc5c(ccn5C)c4)c(F)cc3[nH]2)cc1C(=O)O.
What is the InChIKey of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
The InChIKey is JMUKPJFSDCHARV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F2N3O3/c1-12-3-5-15(10-16(12)23(30)31)32-24-27-18-11-17(25)20(21(26)22(18)28-24)14-4-6-19-13(9-14)7-8-29(19)2/h3-11H,1-2H3,(H,27,28)(H,30,31).
What are the key properties of 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid?
5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid has a molecular weight of 433.41 g/mol, XLogP of 5.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4,6-difluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid is sourced from PubChem (CID 45256863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).