C22H32N4O3 — CID 45256915
(2S,3S)-3-hydroxy-N-[[4-(5-octyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 45256915) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-N-[[4-(5-octyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-3-hydroxy-N-[[4-(5-octyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45256915 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (2S,3S)-3-hydroxy-N-[[4-(5-octyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCCCCCc1nc(-c2ccc(CNC(=O)[C@H]3NCC[C@@H]3O)cc2)no1 |
| InChI | InChI=1S/C22H32N4O3/c1-2-3-4-5-6-7-8-19-25-21(26-29-19)17-11-9-16(10-12-17)15-24-22(28)20-18(27)13-14-23-20/h9-12,18,20,23,27H,2-8,13-15H2,1H3,(H,24,28)/t18-,20-/m0/s1 |
| InChIKey | DLYAQMVDDCYWQR-ICSRJNTNSA-N |
| XLogP | 2.98 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|