C19H26N4O3 — CID 45256919
(2S,3S)-3-hydroxy-N-[[4-(5-pentyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 45256919) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-N-[[4-(5-pentyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,3S)-3-hydroxy-N-[[4-(5-pentyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45256919 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (2S,3S)-3-hydroxy-N-[[4-(5-pentyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCCc1nc(-c2ccc(CNC(=O)[C@H]3NCC[C@@H]3O)cc2)no1 |
| InChI | InChI=1S/C19H26N4O3/c1-2-3-4-5-16-22-18(23-26-16)14-8-6-13(7-9-14)12-21-19(25)17-15(24)10-11-20-17/h6-9,15,17,20,24H,2-5,10-12H2,1H3,(H,21,25)/t15-,17-/m0/s1 |
| InChIKey | APBXTTPJGSJQBJ-RDJZCZTQSA-N |
| XLogP | 1.81 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|