C16H14O5 — CID 45257251
2-[(1R,3R)-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid (PubChem CID 45257251) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-[(1R,3R)-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid.
| Compound Name | 2-[(1R,3R)-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid |
|---|---|
| PubChem CID | 45257251 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(1R,3R)-1-methyl-5,10-dioxo-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid |
| SMILES | C[C@H]1O[C@@H](CC(=O)O)CC2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H14O5/c1-8-14-12(6-9(21-8)7-13(17)18)15(19)10-4-2-3-5-11(10)16(14)20/h2-5,8-9H,6-7H2,1H3,(H,17,18)/t8-,9-/m1/s1 |
| InChIKey | VFSMYOQTRVFZER-RKDXNWHRSA-N |
| XLogP | 2.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|