C33H49N4O6 — CID 45257265
CID 45257265 (PubChem CID 45257265) has the molecular formula C33H49N4O6 and a molecular weight of 597.78 g/mol.
| Compound Name | CID 45257265 |
|---|---|
| PubChem CID | 45257265 |
| Molecular Formula | C33H49N4O6 |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.37 |
| IUPAC Name | — |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)CC(=O)N[C@H](C(=O)N[C@H](Cc1ccccc1)C(=O)NC[C]1[CH][CH][CH][CH]1)C(C)C |
| InChI | InChI=1S/C33H49N4O6/c1-21(2)17-25(36-32(42)43-33(5,6)7)27(38)19-28(39)37-29(22(3)4)31(41)35-26(18-23-13-9-8-10-14-23)30(40)34-20-24-15-11-12-16-24/h8-16,21-22,25-27,29,38H,17-20H2,1-7H3,(H,34,40)(H,35,41)(H,36,42)(H,37,39)/t25-,26+,27-,29-/m0/s1 |
| InChIKey | ILGYQMLCZIEGNG-UMNYJUJISA-N |
| XLogP | 3.07 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |