C42H48O6 — CID 45257340
[(3R,5S,8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-11-oxo-17-(2-trityloxyacetyl)-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 45257340) has the molecular formula C42H48O6 and a molecular weight of 648.84 g/mol. Its IUPAC name is [(3R,5S,8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-11-oxo-17-(2-trityloxyacetyl)-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-11-oxo-17-(2-trityloxyacetyl)-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 45257340 |
| Molecular Formula | C42H48O6 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | [(3R,5S,8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-11-oxo-17-(2-trityloxyacetyl)-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2C(=O)C[C@@]2(C)[C@H]3CC[C@]2(O)C(=O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C42H48O6/c1-28(43)48-33-21-23-39(2)32(25-33)19-20-34-35-22-24-41(46,40(35,3)26-36(44)38(34)39)37(45)27-47-42(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-18,32-35,38,46H,19-27H2,1-3H3/t32-,33+,34-,35-,38+,39-,40-,41-/m0/s1 |
| InChIKey | WUYGSZAZLZFWHH-AYVHCWBVSA-N |
| XLogP | 7.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|