About 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol
2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol (PubChem CID 45257590) has the molecular formula C14H8Br2F2O
and a molecular weight of 390.02 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol.
Molecular Properties
| Compound Name | 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol |
| PubChem CID | 45257590 |
| Molecular Formula | C14H8Br2F2O |
| Molecular Weight | 390.02 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol |
| SMILES | Oc1c(Br)cc(/C=C/c2c(F)cccc2F)cc1Br |
| InChI | InChI=1S/C14H8Br2F2O/c15-10-6-8(7-11(16)14(10)19)4-5-9-12(17)2-1-3-13(9)18/h1-7,19H/b5-4+ |
| InChIKey | PQZRHBACXSNZCB-SNAWJCMRSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.02 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol?
The IUPAC name of 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol (CID 45257590) is 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol.
What is the SMILES notation for 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol?
The canonical SMILES for 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol is Oc1c(Br)cc(/C=C/c2c(F)cccc2F)cc1Br.
What is the InChIKey of 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol?
The InChIKey is PQZRHBACXSNZCB-SNAWJCMRSA-N. The full InChI is InChI=1S/C14H8Br2F2O/c15-10-6-8(7-11(16)14(10)19)4-5-9-12(17)2-1-3-13(9)18/h1-7,19H/b5-4+.
What are the key properties of 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol?
2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol has a molecular weight of 390.02 g/mol, XLogP of 5.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenol is sourced from PubChem (CID 45257590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).