About 7-phenylmethoxy-4H-1,4-benzothiazin-3-one
7-phenylmethoxy-4H-1,4-benzothiazin-3-one (PubChem CID 45257678) has the molecular formula C15H13NO2S
and a molecular weight of 271.34 g/mol. Its IUPAC name is 7-phenylmethoxy-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 7-phenylmethoxy-4H-1,4-benzothiazin-3-one |
| PubChem CID | 45257678 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 7-phenylmethoxy-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2cc(OCc3ccccc3)ccc2N1 |
| InChI | InChI=1S/C15H13NO2S/c17-15-10-19-14-8-12(6-7-13(14)16-15)18-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,16,17) |
| InChIKey | JORISQLHMKNZBT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-phenylmethoxy-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylmethoxy-4H-1,4-benzothiazin-3-one?
The IUPAC name of 7-phenylmethoxy-4H-1,4-benzothiazin-3-one (CID 45257678) is 7-phenylmethoxy-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 7-phenylmethoxy-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 7-phenylmethoxy-4H-1,4-benzothiazin-3-one is O=C1CSc2cc(OCc3ccccc3)ccc2N1.
What is the InChIKey of 7-phenylmethoxy-4H-1,4-benzothiazin-3-one?
The InChIKey is JORISQLHMKNZBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2S/c17-15-10-19-14-8-12(6-7-13(14)16-15)18-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,16,17).
What are the key properties of 7-phenylmethoxy-4H-1,4-benzothiazin-3-one?
7-phenylmethoxy-4H-1,4-benzothiazin-3-one has a molecular weight of 271.34 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylmethoxy-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 45257678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).