C26H48O3Si — CID 45258090
[(2S,3Z,5E)-4-ethyl-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane (PubChem CID 45258090) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is [(2S,3Z,5E)-4-ethyl-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2S,3Z,5E)-4-ethyl-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 45258090 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | [(2S,3Z,5E)-4-ethyl-2-methyl-6-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]hexa-3,5-dienoxy]-tri(propan-2-yl)silane |
| SMILES | CCC(=C/[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)/C=C/[C@H]1CC=C[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C26H48O3Si/c1-11-24(15-16-25-13-12-14-26(29-25)28-19(2)3)17-23(10)18-27-30(20(4)5,21(6)7)22(8)9/h12,14-17,19-23,25-26H,11,13,18H2,1-10H3/b16-15+,24-17-/t23-,25+,26+/m0/s1 |
| InChIKey | NHMPXYILUXRPBW-SKLXNTAFSA-N |
| XLogP | 7.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|