C31H62O3Si2 — CID 45258501
(2R,3R,4Z,8E,10E)-5-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-9-methyloctadeca-4,8,10-triene-1,3-diol (PubChem CID 45258501) has the molecular formula C31H62O3Si2 and a molecular weight of 539.01 g/mol. Its IUPAC name is (2R,3R,4Z,8E,10E)-5-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-9-methyloctadeca-4,8,10-triene-1,3-diol.
| Compound Name | (2R,3R,4Z,8E,10E)-5-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-9-methyloctadeca-4,8,10-triene-1,3-diol |
|---|---|
| PubChem CID | 45258501 |
| Molecular Formula | C31H62O3Si2 |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | (2R,3R,4Z,8E,10E)-5-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-9-methyloctadeca-4,8,10-triene-1,3-diol |
| SMILES | CCCCCCC/C=C/C(C)=C/CC/C(=C/[C@@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H62O3Si2/c1-13-14-15-16-17-18-19-21-26(2)22-20-23-27(35(9,10)30(3,4)5)24-28(33)29(25-32)34-36(11,12)31(6,7)8/h19,21-22,24,28-29,32-33H,13-18,20,23,25H2,1-12H3/b21-19+,26-22+,27-24-/t28-,29-/m1/s1 |
| InChIKey | FOPIWWGMMJEWAQ-PTJSVDPHSA-N |
| XLogP | 9.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|