C11H19NO3 — CID 45258939
(2S,4Z)-2-hydroxy-N-methoxy-N,5-dimethylocta-4,7-dienamide (PubChem CID 45258939) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2S,4Z)-2-hydroxy-N-methoxy-N,5-dimethylocta-4,7-dienamide.
| Compound Name | (2S,4Z)-2-hydroxy-N-methoxy-N,5-dimethylocta-4,7-dienamide |
|---|---|
| PubChem CID | 45258939 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (2S,4Z)-2-hydroxy-N-methoxy-N,5-dimethylocta-4,7-dienamide |
| SMILES | C=CC/C(C)=C\C[C@H](O)C(=O)N(C)OC |
| InChI | InChI=1S/C11H19NO3/c1-5-6-9(2)7-8-10(13)11(14)12(3)15-4/h5,7,10,13H,1,6,8H2,2-4H3/b9-7-/t10-/m0/s1 |
| InChIKey | KPZGADUIQYUMQH-RNKPRXRFSA-N |
| XLogP | 1.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|