C15H21ClN2O4 — CID 45259301
(3S)-2,2-dimethyl-7-nitro-4-pyrrolidin-1-yl-3,4-dihydrochromen-3-ol;hydrochloride (PubChem CID 45259301) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-7-nitro-4-pyrrolidin-1-yl-3,4-dihydrochromen-3-ol;hydrochloride.
| Compound Name | (3S)-2,2-dimethyl-7-nitro-4-pyrrolidin-1-yl-3,4-dihydrochromen-3-ol;hydrochloride |
|---|---|
| PubChem CID | 45259301 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (3S)-2,2-dimethyl-7-nitro-4-pyrrolidin-1-yl-3,4-dihydrochromen-3-ol;hydrochloride |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])ccc2C(N2CCCC2)[C@@H]1O.Cl |
| InChI | InChI=1S/C15H20N2O4.ClH/c1-15(2)14(18)13(16-7-3-4-8-16)11-6-5-10(17(19)20)9-12(11)21-15;/h5-6,9,13-14,18H,3-4,7-8H2,1-2H3;1H/t13?,14-;/m0./s1 |
| InChIKey | DAYUFGHUOSGYEP-IJDFPQMLSA-N |
| XLogP | 2.69 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|