About (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride
(2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride (PubChem CID 45259312) has the molecular formula C11H15ClN2O2
and a molecular weight of 242.71 g/mol. Its IUPAC name is (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride.
Molecular Properties
| Compound Name | (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride |
| PubChem CID | 45259312 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride |
| SMILES | Cl.O=C(O)/C=C/CC/C=C\Cn1ccnc1 |
| InChI | InChI=1S/C11H14N2O2.ClH/c14-11(15)6-4-2-1-3-5-8-13-9-7-12-10-13;/h3-7,9-10H,1-2,8H2,(H,14,15);1H/b5-3-,6-4+; |
| InChIKey | ZJIFRDZOHLOOSE-HQWJOSOMSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride?
The IUPAC name of (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride (CID 45259312) is (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride.
What is the SMILES notation for (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride?
The canonical SMILES for (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride is Cl.O=C(O)/C=C/CC/C=C\Cn1ccnc1.
What is the InChIKey of (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride?
The InChIKey is ZJIFRDZOHLOOSE-HQWJOSOMSA-N. The full InChI is InChI=1S/C11H14N2O2.ClH/c14-11(15)6-4-2-1-3-5-8-13-9-7-12-10-13;/h3-7,9-10H,1-2,8H2,(H,14,15);1H/b5-3-,6-4+;.
What are the key properties of (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride?
(2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride has a molecular weight of 242.71 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6Z)-8-imidazol-1-ylocta-2,6-dienoic acid;hydrochloride is sourced from PubChem (CID 45259312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).