About 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride
4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride (PubChem CID 45259316) has the molecular formula C11H14ClN3S
and a molecular weight of 255.77 g/mol. Its IUPAC name is 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride |
| PubChem CID | 45259316 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride |
| SMILES | Cl.c1cc2sccc2c(N2CCNCC2)n1 |
| InChI | InChI=1S/C11H13N3S.ClH/c1-3-13-11(9-2-8-15-10(1)9)14-6-4-12-5-7-14;/h1-3,8,12H,4-7H2;1H |
| InChIKey | INUOKPQZHKHMHH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride?
The IUPAC name of 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride (CID 45259316) is 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride.
What is the SMILES notation for 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride?
The canonical SMILES for 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride is Cl.c1cc2sccc2c(N2CCNCC2)n1.
What is the InChIKey of 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride?
The InChIKey is INUOKPQZHKHMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S.ClH/c1-3-13-11(9-2-8-15-10(1)9)14-6-4-12-5-7-14;/h1-3,8,12H,4-7H2;1H.
What are the key properties of 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride?
4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride has a molecular weight of 255.77 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-ylthieno[3,2-c]pyridine;hydrochloride is sourced from PubChem (CID 45259316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).