C22H29ClN4O3S — CID 45259320
3-[4-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione;hydrochloride (PubChem CID 45259320) has the molecular formula C22H29ClN4O3S and a molecular weight of 465.02 g/mol. Its IUPAC name is 3-[4-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione;hydrochloride.
| Compound Name | 3-[4-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 45259320 |
| Molecular Formula | C22H29ClN4O3S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 3-[4-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1-thia-3-azaspiro[4.4]nonane-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1SC2(CCCC2)C(=O)N1CCCCN1CCN(c2nccc3occc23)CC1 |
| InChI | InChI=1S/C22H28N4O3S.ClH/c27-20-22(7-1-2-8-22)30-21(28)26(20)11-4-3-10-24-12-14-25(15-13-24)19-17-6-16-29-18(17)5-9-23-19;/h5-6,9,16H,1-4,7-8,10-15H2;1H |
| InChIKey | VRKDJFQXIYDWFQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|