C22H25ClN4O3S2 — CID 45259326
1,1-dioxo-2-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one;hydrochloride (PubChem CID 45259326) has the molecular formula C22H25ClN4O3S2 and a molecular weight of 493.05 g/mol. Its IUPAC name is 1,1-dioxo-2-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one;hydrochloride.
| Compound Name | 1,1-dioxo-2-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one;hydrochloride |
|---|---|
| PubChem CID | 45259326 |
| Molecular Formula | C22H25ClN4O3S2 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1,1-dioxo-2-[4-(4-thieno[3,2-c]pyridin-4-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2S(=O)(=O)N1CCCCN1CCN(c2nccc3sccc23)CC1 |
| InChI | InChI=1S/C22H24N4O3S2.ClH/c27-22-18-5-1-2-6-20(18)31(28,29)26(22)11-4-3-10-24-12-14-25(15-13-24)21-17-8-16-30-19(17)7-9-23-21;/h1-2,5-9,16H,3-4,10-15H2;1H |
| InChIKey | MGZBPIHIZOZRPA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|