C23H33ClN4O3 — CID 45259329
4,4-dimethyl-1-[4-[4-(2-methylfuro[3,2-c]pyridin-4-yl)piperazin-1-yl]butyl]piperidine-2,6-dione;hydrochloride (PubChem CID 45259329) has the molecular formula C23H33ClN4O3 and a molecular weight of 449.00 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-[4-(2-methylfuro[3,2-c]pyridin-4-yl)piperazin-1-yl]butyl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 4,4-dimethyl-1-[4-[4-(2-methylfuro[3,2-c]pyridin-4-yl)piperazin-1-yl]butyl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 45259329 |
| Molecular Formula | C23H33ClN4O3 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4,4-dimethyl-1-[4-[4-(2-methylfuro[3,2-c]pyridin-4-yl)piperazin-1-yl]butyl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cc1cc2c(N3CCN(CCCCN4C(=O)CC(C)(C)CC4=O)CC3)nccc2o1.Cl |
| InChI | InChI=1S/C23H32N4O3.ClH/c1-17-14-18-19(30-17)6-7-24-22(18)26-12-10-25(11-13-26)8-4-5-9-27-20(28)15-23(2,3)16-21(27)29;/h6-7,14H,4-5,8-13,15-16H2,1-3H3;1H |
| InChIKey | LMUHHUAJPDPBMG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|