About N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride
N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride (PubChem CID 45259376) has the molecular formula C22H27ClN4O2S
and a molecular weight of 447.00 g/mol. Its IUPAC name is N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride.
Molecular Properties
| Compound Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride |
| PubChem CID | 45259376 |
| Molecular Formula | C22H27ClN4O2S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCN1CCN(c2nsc3ccccc23)CC1)c1ccccc1O |
| InChI | InChI=1S/C22H26N4O2S.ClH/c27-19-9-3-1-7-17(19)22(28)23-11-5-6-12-25-13-15-26(16-14-25)21-18-8-2-4-10-20(18)29-24-21;/h1-4,7-10,27H,5-6,11-16H2,(H,23,28);1H |
| InChIKey | YYADFERWNSQIMU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride?
The IUPAC name of N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride (CID 45259376) is N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride.
What is the SMILES notation for N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride?
The canonical SMILES for N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride is Cl.O=C(NCCCCN1CCN(c2nsc3ccccc23)CC1)c1ccccc1O.
What is the InChIKey of N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride?
The InChIKey is YYADFERWNSQIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O2S.ClH/c27-19-9-3-1-7-17(19)22(28)23-11-5-6-12-25-13-15-26(16-14-25)21-18-8-2-4-10-20(18)29-24-21;/h1-4,7-10,27H,5-6,11-16H2,(H,23,28);1H.
What are the key properties of N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride?
N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride has a molecular weight of 447.00 g/mol, XLogP of 3.76, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-hydroxybenzamide;hydrochloride is sourced from PubChem (CID 45259376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).