C22H27ClN4OS — CID 45259398
N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride (PubChem CID 45259398) has the molecular formula C22H27ClN4OS and a molecular weight of 431.01 g/mol. Its IUPAC name is N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride.
| Compound Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 45259398 |
| Molecular Formula | C22H27ClN4OS |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCN1CCN(c2nsc3ccccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H26N4OS.ClH/c27-22(18-8-2-1-3-9-18)23-12-6-7-13-25-14-16-26(17-15-25)21-19-10-4-5-11-20(19)28-24-21;/h1-5,8-11H,6-7,12-17H2,(H,23,27);1H |
| InChIKey | KKPSHDOACNZGNT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|