About 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide
2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide (PubChem CID 45259450) has the molecular formula C9H17BrN4S
and a molecular weight of 293.23 g/mol. Its IUPAC name is 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide |
| PubChem CID | 45259450 |
| Molecular Formula | C9H17BrN4S |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide |
| SMILES | Br.C/N=C(/SCCc1cnc[nH]1)N(C)C |
| InChI | InChI=1S/C9H16N4S.BrH/c1-10-9(13(2)3)14-5-4-8-6-11-7-12-8;/h6-7H,4-5H2,1-3H3,(H,11,12);1H/b10-9+; |
| InChIKey | BHTPNNUNZQOCRH-RRABGKBLSA-N |
| XLogP | 1.81 |
| TPSA | 44.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide?
The IUPAC name of 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide (CID 45259450) is 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide.
What is the SMILES notation for 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide?
The canonical SMILES for 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide is Br.C/N=C(/SCCc1cnc[nH]1)N(C)C.
What is the InChIKey of 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide?
The InChIKey is BHTPNNUNZQOCRH-RRABGKBLSA-N. The full InChI is InChI=1S/C9H16N4S.BrH/c1-10-9(13(2)3)14-5-4-8-6-11-7-12-8;/h6-7H,4-5H2,1-3H3,(H,11,12);1H/b10-9+;.
What are the key properties of 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide?
2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide has a molecular weight of 293.23 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-5-yl)ethyl N,N,N'-trimethylcarbamimidothioate;hydrobromide is sourced from PubChem (CID 45259450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).