About methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride
methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride (PubChem CID 45259460) has the molecular formula C6H14Cl2N4O2
and a molecular weight of 245.11 g/mol. Its IUPAC name is methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride |
| PubChem CID | 45259460 |
| Molecular Formula | C6H14Cl2N4O2 |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(N)/C(N)=N/CCC(=O)OC |
| InChI | InChI=1S/C6H12N4O2.2ClH/c1-12-4(11)2-3-10-6(9)5(7)8;;/h2-3H2,1H3,(H3,7,8)(H2,9,10);2*1H |
| InChIKey | ZHSOPYUJNWEMEV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride?
The IUPAC name of methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride (CID 45259460) is methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride.
What is the SMILES notation for methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride?
The canonical SMILES for methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride is Cl.Cl.[H]/N=C(N)/C(N)=N/CCC(=O)OC.
What is the InChIKey of methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride?
The InChIKey is ZHSOPYUJNWEMEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O2.2ClH/c1-12-4(11)2-3-10-6(9)5(7)8;;/h2-3H2,1H3,(H3,7,8)(H2,9,10);2*1H.
What are the key properties of methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride?
methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride has a molecular weight of 245.11 g/mol, XLogP of -0.31, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1,2-diamino-2-iminoethylidene)amino]propanoate;dihydrochloride is sourced from PubChem (CID 45259460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).