About 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride
4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride (PubChem CID 45259478) has the molecular formula C18H26BrClN2O
and a molecular weight of 401.78 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride |
| PubChem CID | 45259478 |
| Molecular Formula | C18H26BrClN2O |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride |
| SMILES | CN(C(=O)c1ccc(Br)cc1)[C@H]1CCCC[C@@]12CCCN2C.Cl |
| InChI | InChI=1S/C18H25BrN2O.ClH/c1-20-13-5-12-18(20)11-4-3-6-16(18)21(2)17(22)14-7-9-15(19)10-8-14;/h7-10,16H,3-6,11-13H2,1-2H3;1H/t16-,18+;/m0./s1 |
| InChIKey | RITMBTUUFXOURV-KUGOCAJQSA-N |
| XLogP | 4.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride?
The IUPAC name of 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride (CID 45259478) is 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride.
What is the SMILES notation for 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride?
The canonical SMILES for 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride is CN(C(=O)c1ccc(Br)cc1)[C@H]1CCCC[C@@]12CCCN2C.Cl.
What is the InChIKey of 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride?
The InChIKey is RITMBTUUFXOURV-KUGOCAJQSA-N. The full InChI is InChI=1S/C18H25BrN2O.ClH/c1-20-13-5-12-18(20)11-4-3-6-16(18)21(2)17(22)14-7-9-15(19)10-8-14;/h7-10,16H,3-6,11-13H2,1-2H3;1H/t16-,18+;/m0./s1.
What are the key properties of 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride?
4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride has a molecular weight of 401.78 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-methyl-N-[(5R,6S)-1-methyl-1-azaspiro[4.5]decan-6-yl]benzamide;hydrochloride is sourced from PubChem (CID 45259478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).