C22H28ClN5O — CID 45259559
10-(2-aminoethylamino)-14-[2-(diethylamino)ethyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride (PubChem CID 45259559) has the molecular formula C22H28ClN5O and a molecular weight of 413.95 g/mol. Its IUPAC name is 10-(2-aminoethylamino)-14-[2-(diethylamino)ethyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride.
| Compound Name | 10-(2-aminoethylamino)-14-[2-(diethylamino)ethyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
|---|---|
| PubChem CID | 45259559 |
| Molecular Formula | C22H28ClN5O |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 10-(2-aminoethylamino)-14-[2-(diethylamino)ethyl]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
| SMILES | CCN(CC)CCn1nc2c3c(c(NCCN)ccc31)C(=O)c1ccccc1-2.Cl |
| InChI | InChI=1S/C22H27N5O.ClH/c1-3-26(4-2)13-14-27-18-10-9-17(24-12-11-23)19-20(18)21(25-27)15-7-5-6-8-16(15)22(19)28;/h5-10,24H,3-4,11-14,23H2,1-2H3;1H |
| InChIKey | KQSWTIABJRGUDZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|