C31H46ClN5O — CID 45259561
14-[2-(diethylamino)ethyl]-10-[7-(diethylamino)heptylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride (PubChem CID 45259561) has the molecular formula C31H46ClN5O and a molecular weight of 540.20 g/mol. Its IUPAC name is 14-[2-(diethylamino)ethyl]-10-[7-(diethylamino)heptylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride.
| Compound Name | 14-[2-(diethylamino)ethyl]-10-[7-(diethylamino)heptylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
|---|---|
| PubChem CID | 45259561 |
| Molecular Formula | C31H46ClN5O |
| Molecular Weight | 540.20 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | 14-[2-(diethylamino)ethyl]-10-[7-(diethylamino)heptylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
| SMILES | CCN(CC)CCCCCCCNc1ccc2c3c(nn2CCN(CC)CC)-c2ccccc2C(=O)c13.Cl |
| InChI | InChI=1S/C31H45N5O.ClH/c1-5-34(6-2)21-15-11-9-10-14-20-32-26-18-19-27-29-28(26)31(37)25-17-13-12-16-24(25)30(29)33-36(27)23-22-35(7-3)8-4;/h12-13,16-19,32H,5-11,14-15,20-23H2,1-4H3;1H |
| InChIKey | QYWCBTLGIVWPOJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.20 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|