C21H25ClN4O — CID 45259568
10-[2-(diethylamino)ethylamino]-14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride (PubChem CID 45259568) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 10-[2-(diethylamino)ethylamino]-14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride.
| Compound Name | 10-[2-(diethylamino)ethylamino]-14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
|---|---|
| PubChem CID | 45259568 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 10-[2-(diethylamino)ethylamino]-14-methyl-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-8-one;hydrochloride |
| SMILES | CCN(CC)CCNc1ccc2c3c(nn2C)-c2ccccc2C(=O)c13.Cl |
| InChI | InChI=1S/C21H24N4O.ClH/c1-4-25(5-2)13-12-22-16-10-11-17-19-18(16)21(26)15-9-7-6-8-14(15)20(19)23-24(17)3;/h6-11,22H,4-5,12-13H2,1-3H3;1H |
| InChIKey | LDAZBSBKEIHGPB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|