C26H36ClN5O — CID 45259593
14-[2-(diethylamino)ethyl]-6-[2-(diethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one;hydrochloride (PubChem CID 45259593) has the molecular formula C26H36ClN5O and a molecular weight of 470.06 g/mol. Its IUPAC name is 14-[2-(diethylamino)ethyl]-6-[2-(diethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one;hydrochloride.
| Compound Name | 14-[2-(diethylamino)ethyl]-6-[2-(diethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one;hydrochloride |
|---|---|
| PubChem CID | 45259593 |
| Molecular Formula | C26H36ClN5O |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 14-[2-(diethylamino)ethyl]-6-[2-(diethylamino)ethylamino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one;hydrochloride |
| SMILES | CCN(CC)CCNc1cccc2c1C(=O)c1cccc3c1c-2nn3CCN(CC)CC.Cl |
| InChI | InChI=1S/C26H35N5O.ClH/c1-5-29(6-2)16-15-27-21-13-9-11-19-23(21)26(32)20-12-10-14-22-24(20)25(19)28-31(22)18-17-30(7-3)8-4;/h9-14,27H,5-8,15-18H2,1-4H3;1H |
| InChIKey | HJXPAUUEAGIDIX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|