C9H17ClN2 — CID 45259623
6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride (PubChem CID 45259623) has the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. Its IUPAC name is 6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride.
| Compound Name | 6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 45259623 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
| SMILES | C=CCC1CCCCN=C1N.Cl |
| InChI | InChI=1S/C9H16N2.ClH/c1-2-5-8-6-3-4-7-11-9(8)10;/h2,8H,1,3-7H2,(H2,10,11);1H |
| InChIKey | MWTWFHGNUIWLLW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|