C14H19ClF3NO3S — CID 45259663
[(7R)-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate;hydrochloride (PubChem CID 45259663) has the molecular formula C14H19ClF3NO3S and a molecular weight of 373.82 g/mol. Its IUPAC name is [(7R)-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate;hydrochloride.
| Compound Name | [(7R)-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 45259663 |
| Molecular Formula | C14H19ClF3NO3S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | [(7R)-7-(propylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate;hydrochloride |
| SMILES | CCCN[C@@H]1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1.Cl |
| InChI | InChI=1S/C14H18F3NO3S.ClH/c1-2-7-18-12-5-3-10-4-6-13(9-11(10)8-12)21-22(19,20)14(15,16)17;/h4,6,9,12,18H,2-3,5,7-8H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | XDVTUCPWTBAABN-UTONKHPSSA-N |
| XLogP | 3.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|