C12H17ClN2 — CID 45259666
2-phenyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride (PubChem CID 45259666) has the molecular formula C12H17ClN2 and a molecular weight of 224.74 g/mol. Its IUPAC name is 2-phenyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride.
| Compound Name | 2-phenyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 45259666 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-phenyl-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
| SMILES | Cl.NC1=NC(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C12H16N2.ClH/c13-12-9-5-4-8-11(14-12)10-6-2-1-3-7-10;/h1-3,6-7,11H,4-5,8-9H2,(H2,13,14);1H |
| InChIKey | XDAVHPHLGGRZID-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |