About 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride
2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride (PubChem CID 45259699) has the molecular formula C17H20ClN3O
and a molecular weight of 317.82 g/mol. Its IUPAC name is 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride |
| PubChem CID | 45259699 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride |
| SMILES | CCCCCOc1ccccc1-c1nc2ccncc2[nH]1.Cl |
| InChI | InChI=1S/C17H19N3O.ClH/c1-2-3-6-11-21-16-8-5-4-7-13(16)17-19-14-9-10-18-12-15(14)20-17;/h4-5,7-10,12H,2-3,6,11H2,1H3,(H,19,20);1H |
| InChIKey | GNCSJISFJQYVFC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride?
The IUPAC name of 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride (CID 45259699) is 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride.
What is the SMILES notation for 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride?
The canonical SMILES for 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride is CCCCCOc1ccccc1-c1nc2ccncc2[nH]1.Cl.
What is the InChIKey of 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride?
The InChIKey is GNCSJISFJQYVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O.ClH/c1-2-3-6-11-21-16-8-5-4-7-13(16)17-19-14-9-10-18-12-15(14)20-17;/h4-5,7-10,12H,2-3,6,11H2,1H3,(H,19,20);1H.
What are the key properties of 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride?
2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride has a molecular weight of 317.82 g/mol, XLogP of 4.62, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pentoxyphenyl)-3H-imidazo[4,5-c]pyridine;hydrochloride is sourced from PubChem (CID 45259699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).