About 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride
3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride (PubChem CID 45259713) has the molecular formula C16H19ClN4O
and a molecular weight of 318.81 g/mol. Its IUPAC name is 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride |
| PubChem CID | 45259713 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride |
| SMILES | CNCCCOc1ccccc1-c1nc2ncccc2[nH]1.Cl |
| InChI | InChI=1S/C16H18N4O.ClH/c1-17-9-5-11-21-14-8-3-2-6-12(14)15-19-13-7-4-10-18-16(13)20-15;/h2-4,6-8,10,17H,5,9,11H2,1H3,(H,18,19,20);1H |
| InChIKey | MQIPAZHFTDBGFD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride?
The IUPAC name of 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride (CID 45259713) is 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride.
What is the SMILES notation for 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride?
The canonical SMILES for 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride is CNCCCOc1ccccc1-c1nc2ncccc2[nH]1.Cl.
What is the InChIKey of 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride?
The InChIKey is MQIPAZHFTDBGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O.ClH/c1-17-9-5-11-21-14-8-3-2-6-12(14)15-19-13-7-4-10-18-16(13)20-15;/h2-4,6-8,10,17H,5,9,11H2,1H3,(H,18,19,20);1H.
What are the key properties of 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride?
3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride has a molecular weight of 318.81 g/mol, XLogP of 3.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenoxy]-N-methylpropan-1-amine;hydrochloride is sourced from PubChem (CID 45259713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).