About 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride
2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride (PubChem CID 45259771) has the molecular formula C15H26ClNO
and a molecular weight of 271.83 g/mol. Its IUPAC name is 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride |
| PubChem CID | 45259771 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)(C)c1cc(O)c(CN)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C15H25NO.ClH/c1-14(2,3)10-7-12(15(4,5)6)11(9-16)13(17)8-10;/h7-8,17H,9,16H2,1-6H3;1H |
| InChIKey | QGKYJXDBHPYJCN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride?
The IUPAC name of 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride (CID 45259771) is 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride.
What is the SMILES notation for 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride?
The canonical SMILES for 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride is CC(C)(C)c1cc(O)c(CN)c(C(C)(C)C)c1.Cl.
What is the InChIKey of 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride?
The InChIKey is QGKYJXDBHPYJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO.ClH/c1-14(2,3)10-7-12(15(4,5)6)11(9-16)13(17)8-10;/h7-8,17H,9,16H2,1-6H3;1H.
What are the key properties of 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride?
2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride has a molecular weight of 271.83 g/mol, XLogP of 3.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3,5-ditert-butylphenol;hydrochloride is sourced from PubChem (CID 45259771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).