About 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride
6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride (PubChem CID 45259832) has the molecular formula C9H12Cl3NO
and a molecular weight of 256.56 g/mol. Its IUPAC name is 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride.
Molecular Properties
| Compound Name | 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride |
| PubChem CID | 45259832 |
| Molecular Formula | C9H12Cl3NO |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride |
| SMILES | CCc1c(Cl)cc(CN)c(O)c1Cl.Cl |
| InChI | InChI=1S/C9H11Cl2NO.ClH/c1-2-6-7(10)3-5(4-12)9(13)8(6)11;/h3,13H,2,4,12H2,1H3;1H |
| InChIKey | GPLJWJBWVUJBIF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride?
The IUPAC name of 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride (CID 45259832) is 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride.
What is the SMILES notation for 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride?
The canonical SMILES for 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride is CCc1c(Cl)cc(CN)c(O)c1Cl.Cl.
What is the InChIKey of 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride?
The InChIKey is GPLJWJBWVUJBIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl2NO.ClH/c1-2-6-7(10)3-5(4-12)9(13)8(6)11;/h3,13H,2,4,12H2,1H3;1H.
What are the key properties of 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride?
6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride has a molecular weight of 256.56 g/mol, XLogP of 3.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-2,4-dichloro-3-ethylphenol;hydrochloride is sourced from PubChem (CID 45259832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).