About 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride
2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride (PubChem CID 45259840) has the molecular formula C9H12BrCl2NO3
and a molecular weight of 333.01 g/mol. Its IUPAC name is 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride.
Molecular Properties
| Compound Name | 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride |
| PubChem CID | 45259840 |
| Molecular Formula | C9H12BrCl2NO3 |
| Molecular Weight | 333.01 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1c(Cl)c(OC)c(CN)c(O)c1Br.Cl |
| InChI | InChI=1S/C9H11BrClNO3.ClH/c1-14-8-4(3-12)7(13)5(10)9(15-2)6(8)11;/h13H,3,12H2,1-2H3;1H |
| InChIKey | MMTUMAMINKRXQQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.01 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride?
The IUPAC name of 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride (CID 45259840) is 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride.
What is the SMILES notation for 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride?
The canonical SMILES for 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride is COc1c(Cl)c(OC)c(CN)c(O)c1Br.Cl.
What is the InChIKey of 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride?
The InChIKey is MMTUMAMINKRXQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrClNO3.ClH/c1-14-8-4(3-12)7(13)5(10)9(15-2)6(8)11;/h13H,3,12H2,1-2H3;1H.
What are the key properties of 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride?
2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride has a molecular weight of 333.01 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-6-bromo-4-chloro-3,5-dimethoxyphenol;hydrochloride is sourced from PubChem (CID 45259840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).