About ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride
ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride (PubChem CID 45259933) has the molecular formula C17H23ClN2O4
and a molecular weight of 354.83 g/mol. Its IUPAC name is ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride |
| PubChem CID | 45259933 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride |
| SMILES | CCCOc1cc2c(CN)ncc(C(=O)OCC)c2cc1OC.Cl |
| InChI | InChI=1S/C17H22N2O4.ClH/c1-4-6-23-16-8-12-11(7-15(16)21-3)13(17(20)22-5-2)10-19-14(12)9-18;/h7-8,10H,4-6,9,18H2,1-3H3;1H |
| InChIKey | VCNAYXDUNJWXBZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride?
The IUPAC name of ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride (CID 45259933) is ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride?
The canonical SMILES for ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride is CCCOc1cc2c(CN)ncc(C(=O)OCC)c2cc1OC.Cl.
What is the InChIKey of ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride?
The InChIKey is VCNAYXDUNJWXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4.ClH/c1-4-6-23-16-8-12-11(7-15(16)21-3)13(17(20)22-5-2)10-19-14(12)9-18;/h7-8,10H,4-6,9,18H2,1-3H3;1H.
What are the key properties of ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride?
ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride has a molecular weight of 354.83 g/mol, XLogP of 3.09, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(aminomethyl)-6-methoxy-7-propoxyisoquinoline-4-carboxylate;hydrochloride is sourced from PubChem (CID 45259933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).