About 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride
2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride (PubChem CID 45260061) has the molecular formula C16H17Cl3N2
and a molecular weight of 343.69 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride |
| PubChem CID | 45260061 |
| Molecular Formula | C16H17Cl3N2 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride |
| SMILES | C/N=C(\NC)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C16H16Cl2N2.ClH/c1-19-16(20-2)15(11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12;/h3-10,15H,1-2H3,(H,19,20);1H |
| InChIKey | SNRCGNKVVBJDDS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride?
The IUPAC name of 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride (CID 45260061) is 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride.
What is the SMILES notation for 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride?
The canonical SMILES for 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride is C/N=C(\NC)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1.Cl.
What is the InChIKey of 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride?
The InChIKey is SNRCGNKVVBJDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N2.ClH/c1-19-16(20-2)15(11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12;/h3-10,15H,1-2H3,(H,19,20);1H.
What are the key properties of 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride?
2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride has a molecular weight of 343.69 g/mol, XLogP of 4.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(4-chlorophenyl)-N,N'-dimethylethanimidamide;hydrochloride is sourced from PubChem (CID 45260061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).