C21H31Cl2NO2 — CID 45260086
[(2S,7R,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl] acetate;hydrochloride (PubChem CID 45260086) has the molecular formula C21H31Cl2NO2 and a molecular weight of 400.39 g/mol. Its IUPAC name is [(2S,7R,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl] acetate;hydrochloride.
| Compound Name | [(2S,7R,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl] acetate;hydrochloride |
|---|---|
| PubChem CID | 45260086 |
| Molecular Formula | C21H31Cl2NO2 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [(2S,7R,9aR)-2-tert-butyl-7-(2-chlorophenyl)-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl] acetate;hydrochloride |
| SMILES | CC(=O)O[C@@]1(C(C)(C)C)CCN2C[C@@H](c3ccccc3Cl)CC[C@@H]2C1.Cl |
| InChI | InChI=1S/C21H30ClNO2.ClH/c1-15(24)25-21(20(2,3)4)11-12-23-14-16(9-10-17(23)13-21)18-7-5-6-8-19(18)22;/h5-8,16-17H,9-14H2,1-4H3;1H/t16-,17+,21-;/m0./s1 |
| InChIKey | AYWVYNFRZNTDFE-YNSTVFGJSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |