About 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride
2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride (PubChem CID 45260143) has the molecular formula C18H25ClN2
and a molecular weight of 304.87 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride |
| PubChem CID | 45260143 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride |
| SMILES | CC(C)/N=C(/Cc1ccc2ccccc2c1)NC(C)C.Cl |
| InChI | InChI=1S/C18H24N2.ClH/c1-13(2)19-18(20-14(3)4)12-15-9-10-16-7-5-6-8-17(16)11-15;/h5-11,13-14H,12H2,1-4H3,(H,19,20);1H |
| InChIKey | VBVDNDLUCMTSAW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride?
The IUPAC name of 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride (CID 45260143) is 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride.
What is the SMILES notation for 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride?
The canonical SMILES for 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride is CC(C)/N=C(/Cc1ccc2ccccc2c1)NC(C)C.Cl.
What is the InChIKey of 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride?
The InChIKey is VBVDNDLUCMTSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2.ClH/c1-13(2)19-18(20-14(3)4)12-15-9-10-16-7-5-6-8-17(16)11-15;/h5-11,13-14H,12H2,1-4H3,(H,19,20);1H.
What are the key properties of 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride?
2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride has a molecular weight of 304.87 g/mol, XLogP of 4.61, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-yl-N,N'-di(propan-2-yl)ethanimidamide;hydrochloride is sourced from PubChem (CID 45260143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).