About 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride
2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride (PubChem CID 45260148) has the molecular formula C13H19ClN2O2S
and a molecular weight of 302.83 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride |
| PubChem CID | 45260148 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride |
| SMILES | Cc1ccc(C(=O)/C(=N/O)SCCN(C)C)cc1.Cl |
| InChI | InChI=1S/C13H18N2O2S.ClH/c1-10-4-6-11(7-5-10)12(16)13(14-17)18-9-8-15(2)3;/h4-7,17H,8-9H2,1-3H3;1H/b14-13-; |
| InChIKey | WLNALASULAJMEF-HPWRNOGASA-N |
| XLogP | 2.68 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride (CID 45260148) is 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride is Cc1ccc(C(=O)/C(=N/O)SCCN(C)C)cc1.Cl.
What is the InChIKey of 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride?
The InChIKey is WLNALASULAJMEF-HPWRNOGASA-N. The full InChI is InChI=1S/C13H18N2O2S.ClH/c1-10-4-6-11(7-5-10)12(16)13(14-17)18-9-8-15(2)3;/h4-7,17H,8-9H2,1-3H3;1H/b14-13-;.
What are the key properties of 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride?
2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride has a molecular weight of 302.83 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl (1Z)-N-hydroxy-2-(4-methylphenyl)-2-oxoethanimidothioate;hydrochloride is sourced from PubChem (CID 45260148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).