C21H24Cl3FN4O5S — CID 45260227
[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2,6-diaminohexanoate;dihydrochloride (PubChem CID 45260227) has the molecular formula C21H24Cl3FN4O5S and a molecular weight of 569.87 g/mol. Its IUPAC name is [(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2,6-diaminohexanoate;dihydrochloride.
| Compound Name | [(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2,6-diaminohexanoate;dihydrochloride |
|---|---|
| PubChem CID | 45260227 |
| Molecular Formula | C21H24Cl3FN4O5S |
| Molecular Weight | 569.87 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | [(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethoxy]methyl 2,6-diaminohexanoate;dihydrochloride |
| SMILES | Cl.Cl.NCCCCC(N)C(=O)OCO/C(=C1/C(=O)N(C(N)=O)c2cc(Cl)c(F)cc21)c1cccs1 |
| InChI | InChI=1S/C21H22ClFN4O5S.2ClH/c22-12-9-15-11(8-13(12)23)17(19(28)27(15)21(26)30)18(16-5-3-7-33-16)31-10-32-20(29)14(25)4-1-2-6-24;;/h3,5,7-9,14H,1-2,4,6,10,24-25H2,(H2,26,30);2*1H/b18-17+;; |
| InChIKey | WFTGHLRUGKRXBC-QIKYXUGXSA-N |
| XLogP | 3.65 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|