C28H46ClNO7 — CID 45260250
[(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride (PubChem CID 45260250) has the molecular formula C28H46ClNO7 and a molecular weight of 544.13 g/mol. Its IUPAC name is [(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride.
| Compound Name | [(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 45260250 |
| Molecular Formula | C28H46ClNO7 |
| Molecular Weight | 544.13 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-(3-methylpiperidin-1-yl)acetate;hydrochloride |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)C3(C)C(C(O)C(OC(=O)CN4CCCC(C)C4)[C@@]2(C)O1)C(C)(C)CC[C@@H]3O.Cl |
| InChI | InChI=1S/C28H45NO7.ClH/c1-8-25(5)14-19(31)28(34)26(6)18(30)11-12-24(3,4)22(26)21(33)23(27(28,7)36-25)35-20(32)16-29-13-9-10-17(2)15-29;/h8,17-18,21-23,30,33-34H,1,9-16H2,2-7H3;1H/t17?,18-,21?,22?,23?,25-,26?,27+,28-;/m0./s1 |
| InChIKey | CWRXBAHRZYCHHR-XULJPXFGSA-N |
| XLogP | 2.65 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|