About 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride
6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 45260285) has the molecular formula C17H18ClF2N
and a molecular weight of 309.79 g/mol. Its IUPAC name is 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| PubChem CID | 45260285 |
| Molecular Formula | C17H18ClF2N |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | CN(C)C1CC(c2ccc(F)cc2)c2ccc(F)cc21.Cl |
| InChI | InChI=1S/C17H17F2N.ClH/c1-20(2)17-10-15(11-3-5-12(18)6-4-11)14-8-7-13(19)9-16(14)17;/h3-9,15,17H,10H2,1-2H3;1H |
| InChIKey | CGECTQJRJHIQML-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The IUPAC name of 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CID 45260285) is 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
What is the SMILES notation for 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The canonical SMILES for 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride is CN(C)C1CC(c2ccc(F)cc2)c2ccc(F)cc21.Cl.
What is the InChIKey of 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
The InChIKey is CGECTQJRJHIQML-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N.ClH/c1-20(2)17-10-15(11-3-5-12(18)6-4-11)14-8-7-13(19)9-16(14)17;/h3-9,15,17H,10H2,1-2H3;1H.
What are the key properties of 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride?
6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride has a molecular weight of 309.79 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-(4-fluorophenyl)-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine;hydrochloride is sourced from PubChem (CID 45260285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).