C28H46ClNO8 — CID 45260328
[(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-methyl-2-morpholin-4-ylpropanoate;hydrochloride (PubChem CID 45260328) has the molecular formula C28H46ClNO8 and a molecular weight of 560.13 g/mol. Its IUPAC name is [(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-methyl-2-morpholin-4-ylpropanoate;hydrochloride.
| Compound Name | [(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-methyl-2-morpholin-4-ylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 45260328 |
| Molecular Formula | C28H46ClNO8 |
| Molecular Weight | 560.13 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | [(3R,4aR,10S,10bS)-3-ethenyl-6,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-5-yl] 2-methyl-2-morpholin-4-ylpropanoate;hydrochloride |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)C3(C)C(C(O)C(OC(=O)C(C)(C)N4CCOCC4)[C@@]2(C)O1)C(C)(C)CC[C@@H]3O.Cl |
| InChI | InChI=1S/C28H45NO8.ClH/c1-9-25(6)16-18(31)28(34)26(7)17(30)10-11-23(2,3)20(26)19(32)21(27(28,8)37-25)36-22(33)24(4,5)29-12-14-35-15-13-29;/h9,17,19-21,30,32,34H,1,10-16H2,2-8H3;1H/t17-,19?,20?,21?,25-,26?,27+,28-;/m0./s1 |
| InChIKey | GZVXPHBNKMMYRV-ZJLPLUOVSA-N |
| XLogP | 2.03 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|