C26H42ClNO8 — CID 45260335
[(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-morpholin-4-ylacetate;hydrochloride (PubChem CID 45260335) has the molecular formula C26H42ClNO8 and a molecular weight of 532.07 g/mol. Its IUPAC name is [(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-morpholin-4-ylacetate;hydrochloride.
| Compound Name | [(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-morpholin-4-ylacetate;hydrochloride |
|---|---|
| PubChem CID | 45260335 |
| Molecular Formula | C26H42ClNO8 |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | [(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 2-morpholin-4-ylacetate;hydrochloride |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)C3(C)C(C(OC(=O)CN4CCOCC4)C(O)[C@@]2(C)O1)C(C)(C)CC[C@@H]3O.Cl |
| InChI | InChI=1S/C26H41NO8.ClH/c1-7-23(4)14-17(29)26(32)24(5)16(28)8-9-22(2,3)20(24)19(21(31)25(26,6)35-23)34-18(30)15-27-10-12-33-13-11-27;/h7,16,19-21,28,31-32H,1,8-15H2,2-6H3;1H/t16-,19?,20?,21?,23-,24?,25+,26-;/m0./s1 |
| InChIKey | YFURPKMGPOSEHF-YTSDUZRMSA-N |
| XLogP | 1.25 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|