C29H48ClNO7 — CID 45260349
[(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-piperidin-1-ylbutanoate;hydrochloride (PubChem CID 45260349) has the molecular formula C29H48ClNO7 and a molecular weight of 558.16 g/mol. Its IUPAC name is [(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-piperidin-1-ylbutanoate;hydrochloride.
| Compound Name | [(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-piperidin-1-ylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 45260349 |
| Molecular Formula | C29H48ClNO7 |
| Molecular Weight | 558.16 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | [(3R,4aR,10S,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] 4-piperidin-1-ylbutanoate;hydrochloride |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)C3(C)C(C(OC(=O)CCCN4CCCCC4)C(O)[C@@]2(C)O1)C(C)(C)CC[C@@H]3O.Cl |
| InChI | InChI=1S/C29H47NO7.ClH/c1-7-26(4)18-20(32)29(35)27(5)19(31)13-14-25(2,3)23(27)22(24(34)28(29,6)37-26)36-21(33)12-11-17-30-15-9-8-10-16-30;/h7,19,22-24,31,34-35H,1,8-18H2,2-6H3;1H/t19-,22?,23?,24?,26-,27?,28+,29-;/m0./s1 |
| InChIKey | RAKRFNVEICJVHI-LMYXGNDUSA-N |
| XLogP | 3.19 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.16 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|