About ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride
ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride (PubChem CID 45260381) has the molecular formula C8H12FN3S
and a molecular weight of 201.27 g/mol. Its IUPAC name is ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride.
Molecular Properties
| Compound Name | ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride |
| PubChem CID | 45260381 |
| Molecular Formula | C8H12FN3S |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride |
| SMILES | CCS/C(N)=N\c1ccncc1.F |
| InChI | InChI=1S/C8H11N3S.FH/c1-2-12-8(9)11-7-3-5-10-6-4-7;/h3-6H,2H2,1H3,(H2,9,10,11);1H |
| InChIKey | WPLIKHOGMJMKQO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride?
The IUPAC name of ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride (CID 45260381) is ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride.
What is the SMILES notation for ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride?
The canonical SMILES for ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride is CCS/C(N)=N\c1ccncc1.F.
What is the InChIKey of ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride?
The InChIKey is WPLIKHOGMJMKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S.FH/c1-2-12-8(9)11-7-3-5-10-6-4-7;/h3-6H,2H2,1H3,(H2,9,10,11);1H.
What are the key properties of ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride?
ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride has a molecular weight of 201.27 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N'-pyridin-4-ylcarbamimidothioate;hydrofluoride is sourced from PubChem (CID 45260381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).