About 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride
3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride (PubChem CID 45260426) has the molecular formula C26H33ClN2O4
and a molecular weight of 473.01 g/mol. Its IUPAC name is 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride |
| PubChem CID | 45260426 |
| Molecular Formula | C26H33ClN2O4 |
| Molecular Weight | 473.01 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCCN1CCC(c2ccccc2)CC1)C1(c2ccc([N+](=O)[O-])cc2)CCCC1 |
| InChI | InChI=1S/C26H32N2O4.ClH/c29-25(26(15-4-5-16-26)23-9-11-24(12-10-23)28(30)31)32-20-6-17-27-18-13-22(14-19-27)21-7-2-1-3-8-21;/h1-3,7-12,22H,4-6,13-20H2;1H |
| InChIKey | LUCIDVGHAILORA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.01 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride?
The IUPAC name of 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride (CID 45260426) is 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride.
What is the SMILES notation for 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride?
The canonical SMILES for 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride is Cl.O=C(OCCCN1CCC(c2ccccc2)CC1)C1(c2ccc([N+](=O)[O-])cc2)CCCC1.
What is the InChIKey of 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride?
The InChIKey is LUCIDVGHAILORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O4.ClH/c29-25(26(15-4-5-16-26)23-9-11-24(12-10-23)28(30)31)32-20-6-17-27-18-13-22(14-19-27)21-7-2-1-3-8-21;/h1-3,7-12,22H,4-6,13-20H2;1H.
What are the key properties of 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride?
3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride has a molecular weight of 473.01 g/mol, XLogP of 5.64, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-phenylpiperidin-1-yl)propyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride is sourced from PubChem (CID 45260426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).