C19H28ClN — CID 45260529
(4aR,10bR)-3-cyclohexyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride (PubChem CID 45260529) has the molecular formula C19H28ClN and a molecular weight of 305.89 g/mol. Its IUPAC name is (4aR,10bR)-3-cyclohexyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride.
| Compound Name | (4aR,10bR)-3-cyclohexyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 45260529 |
| Molecular Formula | C19H28ClN |
| Molecular Weight | 305.89 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (4aR,10bR)-3-cyclohexyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)CC[C@H]1CN(C3CCCCC3)CC[C@@H]21 |
| InChI | InChI=1S/C19H27N.ClH/c1-2-7-17(8-3-1)20-13-12-19-16(14-20)11-10-15-6-4-5-9-18(15)19;/h4-6,9,16-17,19H,1-3,7-8,10-14H2;1H/t16-,19+;/m0./s1 |
| InChIKey | OMKVIYQEERUQMP-ZKKBRJJYSA-N |
| XLogP | 4.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |