C32H32Cl2N4O6 — CID 45260672
2-(4-aminophenyl)-N-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxamide;dihydrochloride (PubChem CID 45260672) has the molecular formula C32H32Cl2N4O6 and a molecular weight of 639.54 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 45260672 |
| Molecular Formula | C32H32Cl2N4O6 |
| Molecular Weight | 639.54 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 2-(4-aminophenyl)-N-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxamide;dihydrochloride |
| SMILES | CNC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2ccc(OCc3ccccn3)cc2c(=O)n1-c1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C32H30N4O6.2ClH/c1-34-31(37)29-28(19-15-26(39-2)30(41-4)27(16-19)40-3)24-13-12-23(42-18-21-7-5-6-14-35-21)17-25(24)32(38)36(29)22-10-8-20(33)9-11-22;;/h5-17H,18,33H2,1-4H3,(H,34,37);2*1H |
| InChIKey | WXDYLAVEXPKDDI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|